ChemNet > CAS > 16369-05-4 DL-2-Amino-3-methyl-1-butanol
16369-05-4 DL-2-Amino-3-methyl-1-butanol
| Produkt-Name |
DL-2-Amino-3-methyl-1-butanol |
| Englischer Name |
DL-2-Amino-3-methyl-1-butanol; DL-Valinol; 2-amino-3-methylbutan-1-ol; (2S)-1-hydroxy-3-methylbutan-2-aminium; (2R)-1-hydroxy-3-methylbutan-2-aminium |
| Molekulare Formel |
C5H14NO |
| Molecular Weight |
104.1702 |
| InChI |
InChI=1/C5H13NO/c1-4(2)5(6)3-7/h4-5,7H,3,6H2,1-2H3/p+1/t5-/m0/s1 |
| CAS Registry Number |
16369-05-4 |
| EINECS |
240-425-0 |
| Molecular Structure |
|
| Siedepunkt |
186.8°C at 760 mmHg |
| Flammpunkt |
91.1°C |
| Dampfdruck |
0.182mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
