ChemNet > CAS > 1638-22-8 p-butylphenol
1638-22-8 p-butylphenol
| Produkt-Name |
p-butylphenol |
| Englischer Name |
p-butylphenol; 4-n-Butylphenol; 4-butylphenol |
| Molekulare Formel |
C10H14O |
| Molecular Weight |
150.2176 |
| InChI |
InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
| CAS Registry Number |
1638-22-8 |
| EINECS |
216-672-5 |
| Molecular Structure |
|
| Dichte |
0.977g/cm3 |
| Siedepunkt |
246.2°C at 760 mmHg |
| Brechungsindex |
1.522 |
| Flammpunkt |
121.5°C |
| Dampfdruck |
0.0176mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
