ChemNet > CAS > 1667-00-1 Cyclopropylphenylmethan
1667-00-1 Cyclopropylphenylmethan
| Produkt-Name |
Cyclopropylphenylmethan |
| Synonyme |
Benzylcyclopropan; (Cyclopropylmethyl)benzol |
| Englischer Name |
Cyclopropylphenylmethane; benzylcyclopropane; (cyclopropylmethyl)benzene |
| Molekulare Formel |
C10H12 |
| Molecular Weight |
132.2023 |
| InChI |
InChI=1/C10H12/c1-2-4-9(5-3-1)8-10-6-7-10/h1-5,10H,6-8H2 |
| CAS Registry Number |
1667-00-1 |
| EINECS |
216-782-3 |
| Molecular Structure |
|
| Dichte |
1.005g/cm3 |
| Siedepunkt |
189.7°C at 760 mmHg |
| Brechungsindex |
1.567 |
| Flammpunkt |
59.1°C |
| Dampfdruck |
0.777mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
