1667-00-1 Cyclopropylphenylmethan
Produkt-Name |
Cyclopropylphenylmethan |
Synonyme |
Benzylcyclopropan; (Cyclopropylmethyl)benzol |
Englischer Name |
Cyclopropylphenylmethane; benzylcyclopropane; (cyclopropylmethyl)benzene |
Molekulare Formel |
C10H12 |
Molecular Weight |
132.2023 |
InChI |
InChI=1/C10H12/c1-2-4-9(5-3-1)8-10-6-7-10/h1-5,10H,6-8H2 |
CAS Registry Number |
1667-00-1 |
EINECS |
216-782-3 |
Molecular Structure |
|
Dichte |
1.005g/cm3 |
Siedepunkt |
189.7°C at 760 mmHg |
Brechungsindex |
1.567 |
Flammpunkt |
59.1°C |
Dampfdruck |
0.777mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|