ChemNet > CAS > 1667-01-2 2',4',6'-Trimethylacetophenone
1667-01-2 2',4',6'-Trimethylacetophenone
Produkt-Name |
2',4',6'-Trimethylacetophenone |
Englischer Name |
2',4',6'-Trimethylacetophenone; 2-Acetylmesitylene; 2,4,6-Trimethylacetophenone; 1-(2,4,6-trimethylphenyl)ethanone |
Molekulare Formel |
C11H14O |
Molecular Weight |
162.2283 |
InChI |
InChI=1/C11H14O/c1-7-5-8(2)11(10(4)12)9(3)6-7/h5-6H,1-4H3 |
CAS Registry Number |
1667-01-2 |
EINECS |
216-783-9 |
Molecular Structure |
|
Dichte |
0.955g/cm3 |
Siedepunkt |
250.2°C at 760 mmHg |
Brechungsindex |
1.509 |
Flammpunkt |
99°C |
Dampfdruck |
0.022mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|