1670-46-8 2-Acetylcyclopentanone
Produkt-Name |
2-Acetylcyclopentanone |
Englischer Name |
2-Acetylcyclopentanone;Cyclopentanone, 2-acetyl-; 4-07-00-01993 (Beilstein Handbook Reference); AI3-19254; BRN 1857601; NSC 141181; alpha-Acetylcyclopentanone; o-Acetylcyclopentanone; 2-Acetylcyclopentan-1-one; (2S)-2-acetylcyclopentanone; 1-(2-hydroxycyclopent-1-en-1-yl)ethanone |
Molekulare Formel |
C7H10O2 |
Molecular Weight |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-5(8)6-3-2-4-7(6)9/h9H,2-4H2,1H3 |
CAS Registry Number |
1670-46-8 |
EINECS |
216-797-5 |
Molecular Structure |
|
Dichte |
1.187g/cm3 |
Siedepunkt |
239.2°C at 760 mmHg |
Brechungsindex |
1.542 |
Flammpunkt |
97.8°C |
Dampfdruck |
0.00713mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|