ChemNet > CAS > 16703-52-9 Ethyl NN-Dimethyloxamate
16703-52-9 Ethyl NN-Dimethyloxamate
| Produkt-Name |
Ethyl NN-Dimethyloxamate |
| Englischer Name |
Ethyl NN-Dimethyloxamate; Ethyl N,N-dimethyloxamate; N,N-Dimethyloxamic acid ethyl ester; ethyl (dimethylamino)(oxo)acetate; Ethyl-N,N-dimethyl oxamate |
| Molekulare Formel |
C6H11NO3 |
| Molecular Weight |
145.1564 |
| InChI |
InChI=1/C6H11NO3/c1-4-10-6(9)5(8)7(2)3/h4H2,1-3H3 |
| CAS Registry Number |
16703-52-9 |
| EINECS |
240-755-5 |
| Molecular Structure |
|
| Dichte |
1.071g/cm3 |
| Siedepunkt |
176.6°C at 760 mmHg |
| Brechungsindex |
1.435 |
| Flammpunkt |
60.6°C |
| Dampfdruck |
1.09mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
