ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
| Produkt-Name |
4-Amino-3-ethylbenzonitrile |
| Englischer Name |
4-Amino-3-ethylbenzonitrile; 4-Cyano-2-ethylaniline |
| Molekulare Formel |
C9H10N2 |
| Molecular Weight |
146.1891 |
| InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
| CAS Registry Number |
170230-87-2 |
| Molecular Structure |
|
| Dichte |
1.07g/cm3 |
| Siedepunkt |
297.1°C at 760 mmHg |
| Brechungsindex |
1.562 |
| Flammpunkt |
133.5°C |
| Dampfdruck |
0.00138mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
