170918-42-0 (R)-Phenyl superquat
Produkt-Name |
(R)-Phenyl superquat |
Synonyme |
;(R)-5,5-Dimethyl-4-phenyl-2-oxazolidinon; (4R)-5,5-Dimethyl-4-phenyl-1,3-oxazolidin-2-on |
Englischer Name |
(R)-Phenyl superquat; (R)-5,5-Dimethyl-4-phenyl-2-oxazolidinone; (4R)-5,5-dimethyl-4-phenyl-1,3-oxazolidin-2-one |
Molekulare Formel |
C11H13NO2 |
Molecular Weight |
191.2264 |
InChI |
InChI=1/C11H13NO2/c1-11(2)9(12-10(13)14-11)8-6-4-3-5-7-8/h3-7,9H,1-2H3,(H,12,13)/t9-/m1/s1 |
CAS Registry Number |
170918-42-0 |
Molecular Structure |
|
Dichte |
1.093g/cm3 |
Schmelzpunkt |
155-159℃ |
Siedepunkt |
383.2°C at 760 mmHg |
Brechungsindex |
1.514 |
Flammpunkt |
185.6°C |
Dampfdruck |
4.47E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|