ChemNet > CAS > 17126-62-4 Ethyl 3-isothiocyanatopropionate
17126-62-4 Ethyl 3-isothiocyanatopropionate
| Produkt-Name |
Ethyl 3-isothiocyanatopropionate |
| Englischer Name |
Ethyl 3-isothiocyanatopropionate; 3-Isothiocyanatopropionic acid ethyl ester; ethyl N-(thioxomethylidene)-beta-alaninate |
| Molekulare Formel |
C6H9NO2S |
| Molecular Weight |
159.2062 |
| InChI |
InChI=1/C6H9NO2S/c1-2-9-6(8)3-4-7-5-10/h2-4H2,1H3 |
| CAS Registry Number |
17126-62-4 |
| Molecular Structure |
|
| Dichte |
1.09g/cm3 |
| Siedepunkt |
242.9°C at 760 mmHg |
| Brechungsindex |
1.498 |
| Flammpunkt |
100.7°C |
| Dampfdruck |
0.033mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
