ChemNet > CAS > 17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
17217-57-1 4,4'-Dimethoxy-2,2'-bipyridine
| Produkt-Name |
4,4'-Dimethoxy-2,2'-bipyridine |
| Englischer Name |
4,4'-Dimethoxy-2,2'-bipyridine; 4,4'-Dimethoxy-[2,2']bipyridinyl |
| Molekulare Formel |
C12H12N2O2 |
| Molecular Weight |
216.2359 |
| InChI |
InChI=1/C12H12N2O2/c1-15-9-3-5-13-11(7-9)12-8-10(16-2)4-6-14-12/h3-8H,1-2H3 |
| CAS Registry Number |
17217-57-1 |
| Molecular Structure |
|
| Dichte |
1.143g/cm3 |
| Schmelzpunkt |
170-171℃ |
| Siedepunkt |
347.6°C at 760 mmHg |
| Brechungsindex |
1.551 |
| Flammpunkt |
127°C |
| Dampfdruck |
0.000107mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|
