17249-79-5;17249-29-5 2,3-Dichlorothiophene
Produkt-Name |
2,3-Dichlorothiophene |
Englischer Name |
2,3-Dichlorothiophene; 2,3-dichloro-thiophene |
Molekulare Formel |
C4H2Cl2S |
Molecular Weight |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
CAS Registry Number |
17249-79-5;17249-29-5 |
Molecular Structure |
|
Dichte |
1.488g/cm3 |
Schmelzpunkt |
-26℃ |
Siedepunkt |
170.7°C at 760 mmHg |
Brechungsindex |
1.584 |
Flammpunkt |
68.9°C |
Dampfdruck |
1.93mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|