ChemNet > CAS > 3333-67-3;16337-84-1;17301-01-8 nickel carbonate
3333-67-3;16337-84-1;17301-01-8 nickel carbonate
| Produkt-Name |
nickel carbonate |
| Englischer Name |
nickel carbonate; Nickel (II) carbonate, anhydrous; Nickel(II) carbonate; C.I. 77779 |
| Molekulare Formel |
NiCO3 |
| Molecular Weight |
118.7034 |
| InChI |
InChI=1/CH2O3.Ni/c2-1(3)4;/h(H2,2,3,4);/p-2 |
| CAS Registry Number |
3333-67-3;16337-84-1;17301-01-8 |
| EINECS |
222-068-2 |
| Molecular Structure |
|
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
R43:May cause sensitization by skin contact.;
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
