1732-08-7 Dimethyl pimelate
Produkt-Name |
Dimethyl pimelate |
Englischer Name |
Dimethyl pimelate; Dimethyl 1,7-Heptanedioate; Heptanedioic acid dimethyl ester; Pimelic acid dimethyl ester; dimethyl heptanedioate |
Molekulare Formel |
C9H16O4 |
Molecular Weight |
188.2209 |
InChI |
InChI=1/C9H16O4/c1-12-8(10)6-4-3-5-7-9(11)13-2/h3-7H2,1-2H3 |
CAS Registry Number |
1732-08-7 |
EINECS |
217-057-4 |
Molecular Structure |
|
Dichte |
1.022g/cm3 |
Siedepunkt |
250.3°C at 760 mmHg |
Brechungsindex |
1.427 |
Flammpunkt |
105.4°C |
Dampfdruck |
0.0219mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|