17598-02-6 Precocene I
Produkt-Name |
Precocene I |
Englischer Name |
Precocene I; 7-Methoxy-2,2-dimethylchromene; 7-methoxy-2,2-dimethyl-2H-chromene |
Molekulare Formel |
C12H14O2 |
Molecular Weight |
190.2384 |
InChI |
InChI=1/C12H14O2/c1-12(2)7-6-9-4-5-10(13-3)8-11(9)14-12/h4-8H,1-3H3 |
CAS Registry Number |
17598-02-6 |
EINECS |
241-566-0 |
Molecular Structure |
|
Dichte |
1.039g/cm3 |
Siedepunkt |
292.7°C at 760 mmHg |
Brechungsindex |
1.519 |
Flammpunkt |
105.1°C |
Dampfdruck |
0.00315mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|