ChemNet > CAS > 17740-40-8 diethyl 1-benzylpyrrolidine-2,5-dicarboxylate
17740-40-8 diethyl 1-benzylpyrrolidine-2,5-dicarboxylate
| Produkt-Name |
diethyl 1-benzylpyrrolidine-2,5-dicarboxylate |
| Englischer Name |
diethyl 1-benzylpyrrolidine-2,5-dicarboxylate; |
| Molekulare Formel |
C17H23NO4 |
| Molecular Weight |
305.3688 |
| InChI |
InChI=1/C17H23NO4/c1-3-21-16(19)14-10-11-15(17(20)22-4-2)18(14)12-13-8-6-5-7-9-13/h5-9,14-15H,3-4,10-12H2,1-2H3 |
| CAS Registry Number |
17740-40-8 |
| Molecular Structure |
|
| Dichte |
1.146g/cm3 |
| Siedepunkt |
381.3°C at 760 mmHg |
| Brechungsindex |
1.53 |
| Flammpunkt |
184.4°C |
| Dampfdruck |
5.14E-06mmHg at 25°C |
| Gefahrensymbole |
 C:Corrosive;
|
| Risk Codes |
R34:Causes burns.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
