18166-64-8 p-Chlorocinnamamide
Produkt-Name |
p-Chlorocinnamamide |
Englischer Name |
p-Chlorocinnamamide; 4-Chlorocinnamamide; (2E)-3-(4-chlorophenyl)prop-2-enamide |
Molekulare Formel |
C9H8ClNO |
Molecular Weight |
181.6189 |
InChI |
InChI=1/C9H8ClNO/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6H,(H2,11,12)/b6-3+ |
CAS Registry Number |
18166-64-8 |
Molecular Structure |
|
Dichte |
1.268g/cm3 |
Siedepunkt |
390.2°C at 760 mmHg |
Brechungsindex |
1.624 |
Flammpunkt |
189.8°C |
Dampfdruck |
2.7E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|