ChemNet > CAS > 18190-44-8 N-(2-Hydroxyethyl)succinimide
18190-44-8 N-(2-Hydroxyethyl)succinimide
| Produkt-Name |
N-(2-Hydroxyethyl)succinimide |
| Englischer Name |
N-(2-Hydroxyethyl)succinimide;1-(2-hydroxyethyl)pyrrolidine-2,5-dione |
| Molekulare Formel |
C6H9NO3 |
| Molecular Weight |
143.1406 |
| InChI |
InChI=1/C6H9NO3/c8-4-3-7-5(9)1-2-6(7)10/h8H,1-4H2 |
| CAS Registry Number |
18190-44-8 |
| Molecular Structure |
|
| Dichte |
1.327g/cm3 |
| Schmelzpunkt |
57-61℃ |
| Siedepunkt |
351.8°C at 760 mmHg |
| Brechungsindex |
1.526 |
| Flammpunkt |
166.6°C |
| Dampfdruck |
2.36E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
