ChemNet > CAS > 18212-20-9 Ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate
18212-20-9 Ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate
| Produkt-Name |
Ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate |
| Englischer Name |
Ethyl 4-methyl-1,2,3-thiadiazole-5-carboxylate; 4-Methyl-1,2,3-thiadiazole-5-carboxylic acid ethyl ester |
| Molekulare Formel |
C6H8N2O2S |
| Molecular Weight |
172.2049 |
| InChI |
InChI=1/C6H8N2O2S/c1-3-10-6(9)5-4(2)7-8-11-5/h3H2,1-2H3 |
| CAS Registry Number |
18212-20-9 |
| Molecular Structure |
|
| Dichte |
1.265g/cm3 |
| Siedepunkt |
241.7°C at 760 mmHg |
| Brechungsindex |
1.53 |
| Flammpunkt |
100°C |
| Dampfdruck |
0.0354mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
