1829-28-3 Ethyl 2-iodobenzoate
Produkt-Name |
Ethyl 2-iodobenzoate |
Englischer Name |
Ethyl 2-iodobenzoate; Ethyl 2-iodobenzoate, (2-Iodobenzoic acid ethyl ester); 2-Iodobenzoic acid ethyl ester |
Molekulare Formel |
C9H9IO2 |
Molecular Weight |
276.071 |
InChI |
InChI=1/C9H9IO2/c1-2-12-9(11)7-5-3-4-6-8(7)10/h3-6H,2H2,1H3 |
CAS Registry Number |
1829-28-3 |
Molecular Structure |
|
Dichte |
1.664g/cm3 |
Siedepunkt |
275.6°C at 760 mmHg |
Brechungsindex |
1.584 |
Flammpunkt |
120.5°C |
Dampfdruck |
0.00505mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|