ChemNet > CAS > 1877-71-0 Methyl hydrogen isophthalate
1877-71-0 Methyl hydrogen isophthalate
| Produkt-Name |
Methyl hydrogen isophthalate |
| Englischer Name |
Methyl hydrogen isophthalate; Monomethyl isophthalate; Isophthalic acid monomethyl ester; Benzene-1,3-dicarboxylic acid monomethyl ester; 3-(methoxycarbonyl)benzoic acid; Mono-methyl isophthalate; Isophthalic acid methyl ester |
| Molekulare Formel |
C9H8O4 |
| Molecular Weight |
180.1574 |
| InChI |
InChI=1/C9H8O4/c1-13-9(12)7-4-2-3-6(5-7)8(10)11/h2-5H,1H3,(H,10,11) |
| CAS Registry Number |
1877-71-0 |
| Molecular Structure |
|
| Dichte |
1.288g/cm3 |
| Schmelzpunkt |
194-196℃ |
| Siedepunkt |
339.3°C at 760 mmHg |
| Brechungsindex |
1.556 |
| Flammpunkt |
139.6°C |
| Dampfdruck |
3.6E-05mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
