ChemNet > CAS > 1877-73-2 3-Nitrophenylacetic acid
1877-73-2 3-Nitrophenylacetic acid
| Produkt-Name |
3-Nitrophenylacetic acid |
| Englischer Name |
3-Nitrophenylacetic acid; (3-nitrophenyl)acetic acid; (3-nitrophenyl)acetate; m-Nitrophenylacetic acid; (3-nitrophenyl) acetic acid |
| Molekulare Formel |
C8H6NO4 |
| Molecular Weight |
180.1381 |
| InChI |
InChI=1/C8H7NO4/c10-8(11)5-6-2-1-3-7(4-6)9(12)13/h1-4H,5H2,(H,10,11)/p-1 |
| CAS Registry Number |
1877-73-2 |
| EINECS |
217-512-7 |
| Molecular Structure |
|
| Schmelzpunkt |
116-120℃ |
| Siedepunkt |
373.8°C at 760 mmHg |
| Flammpunkt |
169.8°C |
| Dampfdruck |
2.98E-06mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
