ChemNet > CAS > 18927-05-4 Methyl 3-methoxyphenylacetate
18927-05-4 Methyl 3-methoxyphenylacetate
| Produkt-Name |
Methyl 3-methoxyphenylacetate |
| Englischer Name |
Methyl 3-methoxyphenylacetate; Methyl 2-(3-methoxyphenyl)acetate |
| Molekulare Formel |
C10H12O3 |
| Molecular Weight |
180.2005 |
| InChI |
InChI=1/C10H12O3/c1-12-9-5-3-4-8(6-9)7-10(11)13-2/h3-6H,7H2,1-2H3 |
| CAS Registry Number |
18927-05-4 |
| Molecular Structure |
|
| Dichte |
1.083g/cm3 |
| Siedepunkt |
254°C at 760 mmHg |
| Brechungsindex |
1.499 |
| Flammpunkt |
100.2°C |
| Dampfdruck |
0.0176mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
