191-07-1 Coronene
Produkt-Name |
Coronene |
Englischer Name |
Coronene; Hexabenzobenzene; Coronene (purity) |
Molekulare Formel |
C24H12 |
Molecular Weight |
300.3521 |
InChI |
InChI=1/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
CAS Registry Number |
191-07-1 |
EINECS |
205-881-7 |
Molecular Structure |
|
Dichte |
1.467g/cm3 |
Schmelzpunkt |
438-440℃ |
Siedepunkt |
525.6°C at 760 mmHg |
Brechungsindex |
2.139 |
Flammpunkt |
265.2°C |
Dampfdruck |
1.3E-10mmHg at 25°C |
Gefahrensymbole |
Xn:Harmful;
|
Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Safety Beschreibung |
S36/37:Wear suitable protective clothing and gloves.;
|
|