ChemNet > CAS > 19212-42-1 1-(5-Methyl-3-phenylisoxazol-4-yl)ethan-1-on
19212-42-1 1-(5-Methyl-3-phenylisoxazol-4-yl)ethan-1-on
| Produkt-Name |
1-(5-Methyl-3-phenylisoxazol-4-yl)ethan-1-on |
| Synonyme |
1-(5-Methyl-3-phenyl-1,2-oxazol-4-yl)ethanon |
| Englischer Name |
1-(5-methyl-3-phenylisoxazol-4-yl)ethan-1-one;1-(5-methyl-3-phenyl-1,2-oxazol-4-yl)ethanone |
| Molekulare Formel |
C12H11NO2 |
| Molecular Weight |
201.2212 |
| InChI |
InChI=1/C12H11NO2/c1-8(14)11-9(2)15-13-12(11)10-6-4-3-5-7-10/h3-7H,1-2H3 |
| CAS Registry Number |
19212-42-1 |
| Molecular Structure |
|
| Dichte |
1.127g/cm3 |
| Schmelzpunkt |
56℃ |
| Siedepunkt |
359°C at 760 mmHg |
| Brechungsindex |
1.54 |
| Flammpunkt |
170.9°C |
| Dampfdruck |
2.46E-05mmHg at 25°C |
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|