ChemNet > CAS > 19312-06-2 4,4-dimethyl-2-phenyl-2-oxazoline
19312-06-2 4,4-dimethyl-2-phenyl-2-oxazoline
| Produkt-Name |
4,4-dimethyl-2-phenyl-2-oxazoline |
| Englischer Name |
4,4-dimethyl-2-phenyl-2-oxazoline;4,4-dimethyl-2-phenyl-4,5-dihydro-1,3-oxazole |
| Molekulare Formel |
C11H13NO |
| Molecular Weight |
175.227 |
| InChI |
InChI=1/C11H13NO/c1-11(2)8-13-10(12-11)9-6-4-3-5-7-9/h3-7H,8H2,1-2H3 |
| CAS Registry Number |
19312-06-2 |
| Molecular Structure |
|
| Dichte |
1.04g/cm3 |
| Schmelzpunkt |
20-24℃ |
| Siedepunkt |
241.5°C at 760 mmHg |
| Brechungsindex |
1.542 |
| Flammpunkt |
93.2°C |
| Dampfdruck |
0.0555mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
