ChemNet > CAS > 19398-47-1 1,4-Dibromo-2-butanol
19398-47-1 1,4-Dibromo-2-butanol
| Produkt-Name |
1,4-Dibromo-2-butanol |
| Englischer Name |
1,4-Dibromo-2-butanol; 1,4-Dibromo-2-butanol, Pract.; 1-Aminonaphthalene-4-sulfonic acid; 1,4-dibromobutan-2-ol; (2S)-1,4-dibromobutan-2-ol; (2R)-1,4-dibromobutan-2-ol |
| Molekulare Formel |
C4H8Br2O |
| Molecular Weight |
231.9137 |
| InChI |
InChI=1/C4H8Br2O/c5-2-1-4(7)3-6/h4,7H,1-3H2/t4-/m1/s1 |
| CAS Registry Number |
19398-47-1 |
| EINECS |
243-029-6 |
| Molecular Structure |
|
| Dichte |
1.951g/cm3 |
| Siedepunkt |
220.1°C at 760 mmHg |
| Brechungsindex |
1.544 |
| Flammpunkt |
116.5°C |
| Dampfdruck |
0.024mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
