ChemNet > CAS > 1942-52-5 2-Diethylaminoethanethiol hydrochloride
1942-52-5 2-Diethylaminoethanethiol hydrochloride
| Produkt-Name |
2-Diethylaminoethanethiol hydrochloride |
| Englischer Name |
2-Diethylaminoethanethiol hydrochloride; diethyl-2-mercaptoethylammonium chloride; 2-Diethylaminoethanthiol Hydrochloride; 2-(diethylamino)ethanethiol hydrochloride (1:1); N,N-diethyl-2-sulfanylethanaminium |
| Molekulare Formel |
C6H16NS |
| Molecular Weight |
134.2624 |
| InChI |
InChI=1/C6H15NS/c1-3-7(4-2)5-6-8/h8H,3-6H2,1-2H3/p+1 |
| CAS Registry Number |
1942-52-5 |
| EINECS |
217-731-8 |
| Molecular Structure |
|
| Schmelzpunkt |
168-175℃ |
| Siedepunkt |
161.6°C at 760 mmHg |
| Flammpunkt |
51.5°C |
| Dampfdruck |
2.26mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
