1956-10-1 4-nitrophenyl caprylate
Produkt-Name |
4-nitrophenyl caprylate |
Englischer Name |
4-nitrophenyl caprylate; Caprylic acid 4-nitrophenyl ester~4-Nitrophenyl octanoate~Octanoic acid 4-nitrophenyl ester; 4-Nitrophenyl octanoate |
Molekulare Formel |
C14H19NO4 |
Molecular Weight |
265.305 |
InChI |
InChI=1/C14H19NO4/c1-2-3-4-5-6-7-14(16)19-13-10-8-12(9-11-13)15(17)18/h8-11H,2-7H2,1H3 |
CAS Registry Number |
1956-10-1 |
Molecular Structure |
|
Dichte |
1.115g/cm3 |
Siedepunkt |
378.7°C at 760 mmHg |
Brechungsindex |
1.516 |
Flammpunkt |
149.1°C |
Dampfdruck |
6.16E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|