ChemNet > CAS > 19819-98-8 2-Methylphenethyl alcohol
19819-98-8 2-Methylphenethyl alcohol
| Produkt-Name |
2-Methylphenethyl alcohol |
| Englischer Name |
2-Methylphenethyl alcohol; 2-o-tolylethanol; 2-(2-Methylphenyl)ethanol |
| Molekulare Formel |
C9H12O |
| Molecular Weight |
136.191 |
| InChI |
InChI=1/C9H12O/c1-8-4-2-3-5-9(8)6-7-10/h2-5,10H,6-7H2,1H3 |
| CAS Registry Number |
19819-98-8 |
| EINECS |
243-349-6 |
| Molecular Structure |
|
| Dichte |
1.001g/cm3 |
| Siedepunkt |
243.5°C at 760 mmHg |
| Brechungsindex |
1.532 |
| Flammpunkt |
108.3°C |
| Dampfdruck |
0.0172mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
