1984-59-4 2,3-Dichloroanisole
Produkt-Name |
2,3-Dichloroanisole |
Englischer Name |
2,3-Dichloroanisole; 1,2-Dichloro-3-methoxybenzene; ; 1,2-dichloro-3-methoxybenzene |
Molekulare Formel |
C7H6Cl2O |
Molecular Weight |
177.0279 |
InChI |
InChI=1/C7H6Cl2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,1H3 |
CAS Registry Number |
1984-59-4 |
EINECS |
217-853-1 |
Molecular Structure |
|
Dichte |
1.289g/cm3 |
Schmelzpunkt |
30-35℃ |
Siedepunkt |
223.4°C at 760 mmHg |
Brechungsindex |
1.534 |
Flammpunkt |
94.7°C |
Dampfdruck |
0.144mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|