ChemNet > CAS > 2033-30-9 5,6-Dimethyl-2-benzimidazolinone
2033-30-9 5,6-Dimethyl-2-benzimidazolinone
Produkt-Name |
5,6-Dimethyl-2-benzimidazolinone |
Englischer Name |
5,6-Dimethyl-2-benzimidazolinone; 5,6-Dimethyl-2-hydroxybenzimidazole; 5,6-dimethyl-1,3-dihydro-2H-benzimidazol-2-one; 5,6-dimethyl-1H-benzo[d]imidazol-2(3H)-one |
Molekulare Formel |
C9H10N2O |
Molecular Weight |
162.1885 |
InChI |
InChI=1/C9H10N2O/c1-5-3-7-8(4-6(5)2)11-9(12)10-7/h3-4H,1-2H3,(H2,10,11,12) |
CAS Registry Number |
2033-30-9 |
EINECS |
217-993-3 |
Molecular Structure |
|
Dichte |
1.161g/cm3 |
Schmelzpunkt |
300℃ |
Siedepunkt |
174°C at 760 mmHg |
Brechungsindex |
1.567 |
Flammpunkt |
60.7°C |
Dampfdruck |
1.23mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|