2050-23-9 Diethyl suberate
Produkt-Name |
Diethyl suberate |
Englischer Name |
Diethyl suberate; Diethyl suberate, (Diethyl octanedioate; Suberic acid d; 2050-23-9Diethyl suberate; Diethyl octanedioate~Suberic acid diethyl ester; Octanedioic acid diethyl ester~Suberic acid diethyl ester; diethyl octanedioate |
Molekulare Formel |
C12H22O4 |
Molecular Weight |
230.3007 |
InChI |
InChI=1/C12H22O4/c1-3-15-11(13)9-7-5-6-8-10-12(14)16-4-2/h3-10H2,1-2H3 |
CAS Registry Number |
2050-23-9 |
EINECS |
218-084-4 |
Molecular Structure |
|
Dichte |
0.985g/cm3 |
Schmelzpunkt |
5-284℃ |
Siedepunkt |
282.6°C at 760 mmHg |
Brechungsindex |
1.436 |
Flammpunkt |
123.3°C |
Dampfdruck |
0.00332mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|