2051-95-8 3-Benzoylpropionic acid
Produkt-Name |
3-Benzoylpropionic acid |
Englischer Name |
3-Benzoylpropionic acid; 4-oxo-4-phenylbutanoic acid; 2-(3-Carboxyphenyl) Propionic Acid; gamma-oxo-benzenebutanoic acid; 4-oxo-4-phenylbutanoic acid; 3-phenoxypropanoic acid; 4-oxo-4-phenylbutanoate |
Molekulare Formel |
C10H9O3 |
Molecular Weight |
177.1772 |
InChI |
InChI=1/C10H10O3/c11-9(6-7-10(12)13)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13)/p-1 |
CAS Registry Number |
2051-95-8 |
EINECS |
218-135-0 |
Molecular Structure |
|
Schmelzpunkt |
114-118℃ |
Siedepunkt |
359.7°C at 760 mmHg |
Flammpunkt |
185.6°C |
Dampfdruck |
8.39E-06mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|