ChemNet > CAS > 207974-19-4 2,3-difluoromandelic acid
207974-19-4 2,3-difluoromandelic acid
| Produkt-Name |
2,3-difluoromandelic acid |
| Englischer Name |
2,3-difluoromandelic acid; alpha-Hydroxy-2,3-difluorophenylacetic acid; (2,3-difluorophenyl)(hydroxy)acetic acid |
| Molekulare Formel |
C8H6F2O3 |
| Molecular Weight |
188.1282 |
| InChI |
InChI=1/C8H6F2O3/c9-5-3-1-2-4(6(5)10)7(11)8(12)13/h1-3,7,11H,(H,12,13) |
| CAS Registry Number |
207974-19-4 |
| Molecular Structure |
|
| Dichte |
1.522g/cm3 |
| Siedepunkt |
313.3°C at 760 mmHg |
| Brechungsindex |
1.542 |
| Flammpunkt |
143.3°C |
| Dampfdruck |
0.000213mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
