ChemNet > CAS > 208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
208186-78-1 5-Chloro-1,2-dibromo-3-fluorobenzene
| Produkt-Name |
5-Chloro-1,2-dibromo-3-fluorobenzene |
| Englischer Name |
5-Chloro-1,2-dibromo-3-fluorobenzene; 5-Chloro-2,3-dibromo-1-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene; 1,2-Dibromo-5-chloro-3-fluorobenzene |
| Molekulare Formel |
C6H2Br2ClF |
| Molecular Weight |
288.3395 |
| InChI |
InChI=1/C6H2Br2ClF/c7-4-1-3(9)2-5(10)6(4)8/h1-2H |
| CAS Registry Number |
208186-78-1 |
| Molecular Structure |
|
| Dichte |
2.089g/cm3 |
| Siedepunkt |
245.3°C at 760 mmHg |
| Brechungsindex |
1.589 |
| Flammpunkt |
102.1°C |
| Dampfdruck |
0.0454mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
