ChemNet > CAS > 2083-09-2 2,5-Bis(4-biphenylyl)oxazole
2083-09-2 2,5-Bis(4-biphenylyl)oxazole
Produkt-Name |
2,5-Bis(4-biphenylyl)oxazole |
Englischer Name |
2,5-Bis(4-biphenylyl)oxazole; 2,5-di(biphenyl-4-yl)oxazole; 2,5-Bis(4-biphenyl)oxazole; BBO; 2,5-di(biphenyl-4-yl)-1,3-oxazole |
Molekulare Formel |
C27H19NO |
Molecular Weight |
373.4459 |
InChI |
InChI=1/C27H19NO/c1-3-7-20(8-4-1)22-11-15-24(16-12-22)26-19-28-27(29-26)25-17-13-23(14-18-25)21-9-5-2-6-10-21/h1-19H |
CAS Registry Number |
2083-09-2 |
EINECS |
218-220-2 |
Molecular Structure |
|
Dichte |
1.143g/cm3 |
Schmelzpunkt |
238-240℃ |
Siedepunkt |
592.4°C at 760 mmHg |
Brechungsindex |
1.621 |
Flammpunkt |
259.6°C |
Dampfdruck |
2.22E-13mmHg at 25°C |
Gefahrensymbole |
|
Risk Codes |
|
Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|