ChemNet > CAS > 21160-95-2 N-Methyldithiocarbaminsäure, Verbindung mit Methylamin (1:1)
21160-95-2 N-Methyldithiocarbaminsäure, Verbindung mit Methylamin (1:1)
| Produkt-Name |
N-Methyldithiocarbaminsäure, Verbindung mit Methylamin (1:1) |
| Synonyme |
Carbamodithiosäure, N-Methyl-, kompatibel mit Methanamin (1:1); Methylammonium-N-methyldithiocarbamat; Carbamodithiosäure, Methyl-, komp.mit Methanamin (1:1); N-Methyldithiocarbasäure, Verbindung mit Methylamin (1:1); Methylcarbamidiosäure - Methanamin (1:1) |
| Englischer Name |
N-methyldithiocarbamic acid, compound with methylamine (1:1);Carbamodithioic acid, N-methyl-, compd. with methanamine (1:1); Methylammonium N-methyldithiocarbamate; Carbamodithioic acid, methyl-, compd. with methanamine (1:1); N-Methyldithiocarbamic acid, compound with methylamine (1:1); methylcarbamodithioic acid - methanamine (1:1) |
| Molekulare Formel |
C3H10N2S2 |
| Molecular Weight |
138.2549 |
| InChI |
InChI=1/C2H5NS2.CH5N/c1-3-2(4)5;1-2/h1H3,(H2,3,4,5);2H2,1H3 |
| CAS Registry Number |
21160-95-2 |
| EINECS |
244-252-1 |
| Molecular Structure |
|
| Siedepunkt |
120.3°C at 760 mmHg |
| Flammpunkt |
26.6°C |
| Dampfdruck |
15.3mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
|
|
