ChemNet > CAS > 213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
213270-36-1 (S)-2-Isobutylsuccinic acid-1-methyl ester
| Produkt-Name |
(S)-2-Isobutylsuccinic acid-1-methyl ester |
| Englischer Name |
(S)-2-Isobutylsuccinic acid-1-methyl ester; (S)-3-Methoxycarbonyl-5-methylhexanoic acid; (S)-(-)-2-Isobutylsuccinic acid 1-methyl ester; (3S)-3-(methoxycarbonyl)-5-methylhexanoic acid; (3S)-3-(methoxycarbonyl)-5-methylhexanoate; 3-(methoxycarbonyl)-5-methylhexanoic acid |
| Molekulare Formel |
C9H16O4 |
| Molecular Weight |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-6(2)4-7(5-8(10)11)9(12)13-3/h6-7H,4-5H2,1-3H3,(H,10,11) |
| CAS Registry Number |
213270-36-1 |
| Molecular Structure |
|
| Dichte |
1.07g/cm3 |
| Siedepunkt |
288.632°C at 760 mmHg |
| Brechungsindex |
1.447 |
| Flammpunkt |
107.989°C |
| Dampfdruck |
0.001mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
