ChemNet > CAS > 2217-79-0 Diphenyliodonium iodide
2217-79-0 Diphenyliodonium iodide
| Produkt-Name |
Diphenyliodonium iodide |
| Englischer Name |
Diphenyliodonium iodide; AI3-17093; Iodonium, diphenyl-, iodide |
| Molekulare Formel |
C12H10I2 |
| Molecular Weight |
408.02 |
| InChI |
InChI=1/C12H10I.HI/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;/h1-10H;1H/q+1;/p-1 |
| CAS Registry Number |
2217-79-0 |
| EINECS |
218-716-9 |
| Molecular Structure |
|
| Schmelzpunkt |
163-165℃ |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
