ChemNet > CAS > 22282-58-2 2-Iodo-3-methylpyridine
22282-58-2 2-Iodo-3-methylpyridine
| Produkt-Name |
2-Iodo-3-methylpyridine |
| Englischer Name |
2-Iodo-3-methylpyridine; 2-Iodo-3-picoline |
| Molekulare Formel |
C6H6IN |
| Molecular Weight |
219.023 |
| InChI |
InChI=1/C6H6IN/c1-5-3-2-4-8-6(5)7/h2-4H,1H3 |
| CAS Registry Number |
22282-58-2 |
| Molecular Structure |
|
| Dichte |
1.81g/cm3 |
| Siedepunkt |
237.412°C at 760 mmHg |
| Brechungsindex |
1.612 |
| Flammpunkt |
97.384°C |
| Dampfdruck |
0.069mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
