ChemNet > CAS > 22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
22355-34-6 benzoic acid, compound with dicyclohexylamine (1:1)
| Produkt-Name |
benzoic acid, compound with dicyclohexylamine (1:1) |
| Englischer Name |
benzoic acid, compound with dicyclohexylamine (1:1);Benzoic acid, compd. with N-cyclohexylcyclohexanamine (1:1); Benzoic acid dicyclohexylamine salt; Dicyclohexylamine benzoate; Dicyclohexylammonium benzoate; Benzoic acid, compd. with dicyclohexylamine (1:1) (8CI); Benzoic acid, compound with dicyclohexylamine (1:1); Dicyclohexylamine, compd. with benzoic acid (7CI); N-cyclohexylcyclohexanamine benzoate (1:1) |
| Molekulare Formel |
C19H29NO2 |
| Molecular Weight |
303.4391 |
| InChI |
InChI=1/C12H23N.C7H6O2/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;8-7(9)6-4-2-1-3-5-6/h11-13H,1-10H2;1-5H,(H,8,9) |
| CAS Registry Number |
22355-34-6 |
| EINECS |
244-932-8 |
| Molecular Structure |
|
| Siedepunkt |
256.1°C at 760 mmHg |
| Flammpunkt |
96.1°C |
| Dampfdruck |
0.0157mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
|
|
