ChemNet > CAS > 223671-15-6 7-Bromo-1-hydroxyisoquinoline
223671-15-6 7-Bromo-1-hydroxyisoquinoline
| Produkt-Name |
7-Bromo-1-hydroxyisoquinoline |
| Englischer Name |
7-Bromo-1-hydroxyisoquinoline; 7-Bromoisocarbostyril; 7-bromoisoquinolin-1(2H)-one; 7-bromo-1(2H)-isoquinolone |
| Molekulare Formel |
C9H6BrNO |
| Molecular Weight |
224.054 |
| InChI |
InChI=1/C9H6BrNO/c10-7-2-1-6-3-4-11-9(12)8(6)5-7/h1-5H,(H,11,12) |
| CAS Registry Number |
223671-15-6 |
| Molecular Structure |
|
| Dichte |
1.62g/cm3 |
| Siedepunkt |
427.5°C at 760 mmHg |
| Brechungsindex |
1.63 |
| Flammpunkt |
212.4°C |
| Dampfdruck |
1.63E-07mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
