ChemNet > CAS > 22590-64-3 3-(oxiran-2-ylmethoxy)benzaldehyd
22590-64-3 3-(oxiran-2-ylmethoxy)benzaldehyd
| Produkt-Name |
3-(oxiran-2-ylmethoxy)benzaldehyd |
| Englischer Name |
3-(oxiran-2-ylmethoxy)benzaldehyde; |
| Molekulare Formel |
C10H10O3 |
| Molecular Weight |
178.1846 |
| InChI |
InChI=1/C10H10O3/c11-5-8-2-1-3-9(4-8)12-6-10-7-13-10/h1-5,10H,6-7H2 |
| CAS Registry Number |
22590-64-3 |
| Molecular Structure |
|
| Dichte |
1.225g/cm3 |
| Siedepunkt |
318.2°C at 760 mmHg |
| Brechungsindex |
1.581 |
| Flammpunkt |
137.2°C |
| Dampfdruck |
0.000367mmHg at 25°C |
| Gefahrensymbole |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
