ChemNet > CAS > 22776-09-6 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one
22776-09-6 1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one
| Produkt-Name |
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one |
| Englischer Name |
1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethan-1-one;1-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)ethanone |
| Molekulare Formel |
C11H12O3 |
| Molecular Weight |
192.2112 |
| InChI |
InChI=1/C11H12O3/c1-8(12)9-3-4-10-11(7-9)14-6-2-5-13-10/h3-4,7H,2,5-6H2,1H3 |
| CAS Registry Number |
22776-09-6 |
| Molecular Structure |
|
| Dichte |
1.146g/cm3 |
| Siedepunkt |
328.4°C at 760 mmHg |
| Brechungsindex |
1.528 |
| Flammpunkt |
143.5°C |
| Dampfdruck |
0.00019mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|
