ChemNet > CAS > 22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
22900-83-0 ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate
| Produkt-Name |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate |
| Englischer Name |
ethyl 2-bromo-4-methyl-1,3-thiazole-5-carboxylate; ethyl 2-bromo-4-methylthiazole-5-carboxylate |
| Molekulare Formel |
C7H8BrNO2S |
| Molecular Weight |
250.1129 |
| InChI |
InChI=1/C7H8BrNO2S/c1-3-11-6(10)5-4(2)9-7(8)12-5/h3H2,1-2H3 |
| CAS Registry Number |
22900-83-0 |
| Molecular Structure |
|
| Dichte |
1.573g/cm3 |
| Schmelzpunkt |
68℃ |
| Siedepunkt |
287.086°C at 760 mmHg |
| Brechungsindex |
1.563 |
| Flammpunkt |
127.426°C |
| Dampfdruck |
0.003mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
