ChemNet > CAS > 23384-72-7 3,4-difluoropropiophenone
23384-72-7 3,4-difluoropropiophenone
| Produkt-Name |
3,4-difluoropropiophenone |
| Englischer Name |
3,4-difluoropropiophenone;3',4'-Difluoropropiophenone; 1-(3,4-difluorophenyl)propan-1-one |
| Molekulare Formel |
C9H8F2O |
| Molecular Weight |
170.156 |
| InChI |
InChI=1/C9H8F2O/c1-2-9(12)6-3-4-7(10)8(11)5-6/h3-5H,2H2,1H3 |
| CAS Registry Number |
23384-72-7 |
| EINECS |
245-627-2 |
| Molecular Structure |
|
| Dichte |
1.166g/cm3 |
| Siedepunkt |
225°C at 760 mmHg |
| Brechungsindex |
1.472 |
| Flammpunkt |
84.8°C |
| Dampfdruck |
0.0886mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
R36/38:Irritating to eyes and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
