ChemNet > CAS > 2350-89-2 4-Vinylbiphenyl
2350-89-2 4-Vinylbiphenyl
| Produkt-Name |
4-Vinylbiphenyl |
| Englischer Name |
4-Vinylbiphenyl; 4-Phenylstyrene; 4-ethenylbiphenyl |
| Molekulare Formel |
C14H12 |
| Molecular Weight |
180.2451 |
| InChI |
InChI=1/C14H12/c1-2-12-8-10-14(11-9-12)13-6-4-3-5-7-13/h2-11H,1H2 |
| CAS Registry Number |
2350-89-2 |
| EINECS |
219-082-6 |
| Molecular Structure |
|
| Dichte |
0.997g/cm3 |
| Schmelzpunkt |
115-121℃ |
| Siedepunkt |
301.7°C at 760 mmHg |
| Brechungsindex |
1.599 |
| Flammpunkt |
139.4°C |
| Dampfdruck |
0.00185mmHg at 25°C |
| Gefahrensymbole |
|
| Risk Codes |
|
| Safety Beschreibung |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
