ChemNet > CAS > 2358-84-1;129011-76-3 Diethylene glycol dimethacrylate
2358-84-1;129011-76-3 Diethylene glycol dimethacrylate
| Produkt-Name |
Diethylene glycol dimethacrylate |
| Englischer Name |
Diethylene glycol dimethacrylate; 2-propenoic acid, 2-methyl-, oxydi-2,1-ethanediyl ester; Oxydi-2,1-ethanediyl bis(2-methylacrylate); Oxydiethane-2,1-diyl bis(2-methylacrylate); oxydiethane-2,1-diyl bis(2-methylprop-2-enoate); Diethyene Glycol Dimethacrylate |
| Molekulare Formel |
C12H18O5 |
| Molecular Weight |
242.27 |
| InChI |
InChI=1/C12H18O5/c1-9(2)11(13)16-7-5-15-6-8-17-12(14)10(3)4/h1,3,5-8H2,2,4H3 |
| CAS Registry Number |
2358-84-1;129011-76-3 |
| EINECS |
219-099-9 |
| Molecular Structure |
|
| Dichte |
1.082 |
| Siedepunkt |
134℃ (2 mmHg) |
| Brechungsindex |
1.458 |
| Flammpunkt |
>110℃ |
| Gefahrensymbole |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
