ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| Produkt-Name |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Englischer Name |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate; 3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| Molekulare Formel |
C11H15NO3 |
| Molecular Weight |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| CAS Registry Number |
2386-26-7 |
| Molecular Structure |
|
| Dichte |
1.125g/cm3 |
| Schmelzpunkt |
139℃ |
| Siedepunkt |
348.9°C at 760 mmHg |
| Brechungsindex |
1.517 |
| Flammpunkt |
164.8°C |
| Dampfdruck |
4.89E-05mmHg at 25°C |
| Gefahrensymbole |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
